C33H25FNOS+ — CID 166037604
2-[6-[4-(2,3-dihydro-1-benzothiophen-2-yl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166037604) has the molecular formula C33H25FNOS+ and a molecular weight of 502.63 g/mol. Its IUPAC name is 2-[6-[4-(2,3-dihydro-1-benzothiophen-2-yl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-[4-(2,3-dihydro-1-benzothiophen-2-yl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166037604 |
| Molecular Formula | C33H25FNOS+ |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-[6-[4-(2,3-dihydro-1-benzothiophen-2-yl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc(C5Cc6ccccc6S5)cc4)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C33H25FNOS/c1-20-10-15-24-25-16-17-26(34)31(33(25)36-32(24)30(20)27-8-5-6-18-35(27)2)22-13-11-21(12-14-22)29-19-23-7-3-4-9-28(23)37-29/h3-18,29H,19H2,1-2H3/q+1 |
| InChIKey | USBORYXTSKSMNV-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|