About [[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten
[[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten (PubChem CID 166038845) has the molecular formula C9H12N2O2SW
and a molecular weight of 396.11 g/mol. Its IUPAC name is [[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten.
Molecular Properties
| Compound Name | [[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten |
| PubChem CID | 166038845 |
| Molecular Formula | C9H12N2O2SW |
| Molecular Weight | 396.11 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | [[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten |
| SMILES | Cc1ccc(C(=O)NS(C)(=O)=[W])c(N)c1 |
| InChI | InChI=1S/C9H12N2O2S.W/c1-6-3-4-7(8(10)5-6)9(12)11-14(2)13;/h3-5H,10H2,1-2H3,(H,11,12); |
| InChIKey | DVXNPZVUTQXCES-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.11 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten?
The IUPAC name of [[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten (CID 166038845) is [[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten.
What is the SMILES notation for [[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten?
The canonical SMILES for [[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten is Cc1ccc(C(=O)NS(C)(=O)=[W])c(N)c1.
What is the InChIKey of [[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten?
The InChIKey is DVXNPZVUTQXCES-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S.W/c1-6-3-4-7(8(10)5-6)9(12)11-14(2)13;/h3-5H,10H2,1-2H3,(H,11,12);.
What are the key properties of [[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten?
[[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten has a molecular weight of 396.11 g/mol, XLogP of 0.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[(2-amino-4-methylbenzoyl)amino]-methyl-oxo-λ6-sulfanylidene]tungsten is sourced from PubChem (CID 166038845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).