C28H29N5O4S — CID 166039191
tert-butyl (1R,4R,5S)-5-[[2-[4-(methylcarbamoyl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]amino]-2-azabicyclo[2.1.1]hexane-2-carboxylate (PubChem CID 166039191) has the molecular formula C28H29N5O4S and a molecular weight of 531.64 g/mol. Its IUPAC name is tert-butyl (1R,4R,5S)-5-[[2-[4-(methylcarbamoyl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]amino]-2-azabicyclo[2.1.1]hexane-2-carboxylate.
| Compound Name | tert-butyl (1R,4R,5S)-5-[[2-[4-(methylcarbamoyl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]amino]-2-azabicyclo[2.1.1]hexane-2-carboxylate |
|---|---|
| PubChem CID | 166039191 |
| Molecular Formula | C28H29N5O4S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | tert-butyl (1R,4R,5S)-5-[[2-[4-(methylcarbamoyl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]amino]-2-azabicyclo[2.1.1]hexane-2-carboxylate |
| SMILES | CNC(=O)c1ccc(-c2cn3c(n2)sc2cc(C(=O)N[C@H]4[C@@H]5C[C@H]4N(C(=O)OC(C)(C)C)C5)ccc23)cc1 |
| InChI | InChI=1S/C28H29N5O4S/c1-28(2,3)37-27(36)33-13-18-11-21(33)23(18)31-25(35)17-9-10-20-22(12-17)38-26-30-19(14-32(20)26)15-5-7-16(8-6-15)24(34)29-4/h5-10,12,14,18,21,23H,11,13H2,1-4H3,(H,29,34)(H,31,35)/t18-,21-,23+/m1/s1 |
| InChIKey | PLXVVWPJMCQIEM-AAIMPIBUSA-N |
| XLogP | 4.31 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |