About 2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide
2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide (PubChem CID 166039212) has the molecular formula C11H9N3O2S
and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
| PubChem CID | 166039212 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)sc1nc(CO)cn12 |
| InChI | InChI=1S/C11H9N3O2S/c12-10(16)6-1-2-8-9(3-6)17-11-13-7(5-15)4-14(8)11/h1-4,15H,5H2,(H2,12,16) |
| InChIKey | AQFIZPHWRVOSIK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide?
The IUPAC name of 2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide (CID 166039212) is 2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide.
What is the SMILES notation for 2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide?
The canonical SMILES for 2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide is NC(=O)c1ccc2c(c1)sc1nc(CO)cn12.
What is the InChIKey of 2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide?
The InChIKey is AQFIZPHWRVOSIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O2S/c12-10(16)6-1-2-8-9(3-6)17-11-13-7(5-15)4-14(8)11/h1-4,15H,5H2,(H2,12,16).
What are the key properties of 2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide?
2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide has a molecular weight of 247.28 g/mol, XLogP of 1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide is sourced from PubChem (CID 166039212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).