About (E)-5-methoxy-N,N-dimethylpent-3-en-1-amine
(E)-5-methoxy-N,N-dimethylpent-3-en-1-amine (PubChem CID 166041235) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is (E)-5-methoxy-N,N-dimethylpent-3-en-1-amine.
Molecular Properties
| Compound Name | (E)-5-methoxy-N,N-dimethylpent-3-en-1-amine |
| PubChem CID | 166041235 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (E)-5-methoxy-N,N-dimethylpent-3-en-1-amine |
| SMILES | COC/C=C/CCN(C)C |
| InChI | InChI=1S/C8H17NO/c1-9(2)7-5-4-6-8-10-3/h4,6H,5,7-8H2,1-3H3/b6-4+ |
| InChIKey | USVDYYWLYZTAQI-GQCTYLIASA-N |
| XLogP | 1.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-methoxy-N,N-dimethylpent-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-methoxy-N,N-dimethylpent-3-en-1-amine?
The IUPAC name of (E)-5-methoxy-N,N-dimethylpent-3-en-1-amine (CID 166041235) is (E)-5-methoxy-N,N-dimethylpent-3-en-1-amine.
What is the SMILES notation for (E)-5-methoxy-N,N-dimethylpent-3-en-1-amine?
The canonical SMILES for (E)-5-methoxy-N,N-dimethylpent-3-en-1-amine is COC/C=C/CCN(C)C.
What is the InChIKey of (E)-5-methoxy-N,N-dimethylpent-3-en-1-amine?
The InChIKey is USVDYYWLYZTAQI-GQCTYLIASA-N. The full InChI is InChI=1S/C8H17NO/c1-9(2)7-5-4-6-8-10-3/h4,6H,5,7-8H2,1-3H3/b6-4+.
What are the key properties of (E)-5-methoxy-N,N-dimethylpent-3-en-1-amine?
(E)-5-methoxy-N,N-dimethylpent-3-en-1-amine has a molecular weight of 143.23 g/mol, XLogP of 1.14, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-methoxy-N,N-dimethylpent-3-en-1-amine is sourced from PubChem (CID 166041235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).