About 1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine
1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine (PubChem CID 166041680) has the molecular formula C20H37F2NO4
and a molecular weight of 393.52 g/mol. Its IUPAC name is 1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine.
Molecular Properties
| Compound Name | 1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine |
| PubChem CID | 166041680 |
| Molecular Formula | C20H37F2NO4 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine |
| SMILES | CC(C)OC1CC(OCCCOCC(F)(F)COC2CN(C(C)(C)C)C2)C1 |
| InChI | InChI=1S/C20H37F2NO4/c1-15(2)27-17-9-16(10-17)25-8-6-7-24-13-20(21,22)14-26-18-11-23(12-18)19(3,4)5/h15-18H,6-14H2,1-5H3 |
| InChIKey | QFNGLKUSKJSPKE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine?
The IUPAC name of 1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine (CID 166041680) is 1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine.
What is the SMILES notation for 1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine?
The canonical SMILES for 1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine is CC(C)OC1CC(OCCCOCC(F)(F)COC2CN(C(C)(C)C)C2)C1.
What is the InChIKey of 1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine?
The InChIKey is QFNGLKUSKJSPKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37F2NO4/c1-15(2)27-17-9-16(10-17)25-8-6-7-24-13-20(21,22)14-26-18-11-23(12-18)19(3,4)5/h15-18H,6-14H2,1-5H3.
What are the key properties of 1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine?
1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine has a molecular weight of 393.52 g/mol, XLogP of 3.50, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-[2,2-difluoro-3-[3-(3-propan-2-yloxycyclobutyl)oxypropoxy]propoxy]azetidine is sourced from PubChem (CID 166041680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).