C13H23NO — CID 166041962
N-(5-ethyl-2-methylcyclohex-3-en-1-yl)-2-methylpropanamide (PubChem CID 166041962) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is N-(5-ethyl-2-methylcyclohex-3-en-1-yl)-2-methylpropanamide.
| Compound Name | N-(5-ethyl-2-methylcyclohex-3-en-1-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 166041962 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N-(5-ethyl-2-methylcyclohex-3-en-1-yl)-2-methylpropanamide |
| SMILES | CCC1C=CC(C)C(NC(=O)C(C)C)C1 |
| InChI | InChI=1S/C13H23NO/c1-5-11-7-6-10(4)12(8-11)14-13(15)9(2)3/h6-7,9-12H,5,8H2,1-4H3,(H,14,15) |
| InChIKey | IQMUOIOSZGLOGG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|