C34H36N8O5S — CID 166042120
2-[(2S)-2-[[(2S)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 166042120) has the molecular formula C34H36N8O5S and a molecular weight of 668.78 g/mol. Its IUPAC name is 2-[(2S)-2-[[(2S)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[(2S)-2-[[(2S)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 166042120 |
| Molecular Formula | C34H36N8O5S |
| Molecular Weight | 668.78 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | 2-[(2S)-2-[[(2S)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](N)Cc1c[nH]c2ccccc12)C(=O)c1nc2ccc(C(=O)O)cc2s1 |
| InChI | InChI=1S/C34H36N8O5S/c35-23(16-21-18-39-24-10-5-4-9-22(21)24)30(44)41-27(15-19-7-2-1-3-8-19)31(45)40-26(11-6-14-38-34(36)37)29(43)32-42-25-13-12-20(33(46)47)17-28(25)48-32/h1-5,7-10,12-13,17-18,23,26-27,39H,6,11,14-16,35H2,(H,40,45)(H,41,44)(H,46,47)(H4,36,37,38)/t23-,26+,27+/m1/s1 |
| InChIKey | QCQJMYPOICANAT-NPAAKHOSSA-N |
| XLogP | 2.49 |
| TPSA | 231.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.78 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|