C27H33N5O7 — CID 166042379
methyl 2-[5-[(4R)-5-[5-(1,3-dioxolan-2-yl)-2-nitroanilino]-4-methylpentoxy]-1-methylpyrazol-4-yl]-6-methylpyridine-4-carboxylate (PubChem CID 166042379) has the molecular formula C27H33N5O7 and a molecular weight of 539.59 g/mol. Its IUPAC name is methyl 2-[5-[(4R)-5-[5-(1,3-dioxolan-2-yl)-2-nitroanilino]-4-methylpentoxy]-1-methylpyrazol-4-yl]-6-methylpyridine-4-carboxylate.
| Compound Name | methyl 2-[5-[(4R)-5-[5-(1,3-dioxolan-2-yl)-2-nitroanilino]-4-methylpentoxy]-1-methylpyrazol-4-yl]-6-methylpyridine-4-carboxylate |
|---|---|
| PubChem CID | 166042379 |
| Molecular Formula | C27H33N5O7 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | methyl 2-[5-[(4R)-5-[5-(1,3-dioxolan-2-yl)-2-nitroanilino]-4-methylpentoxy]-1-methylpyrazol-4-yl]-6-methylpyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(C)nc(-c2cnn(C)c2OCCC[C@@H](C)CNc2cc(C3OCCO3)ccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H33N5O7/c1-17(15-28-23-13-19(27-38-10-11-39-27)7-8-24(23)32(34)35)6-5-9-37-25-21(16-29-31(25)3)22-14-20(26(33)36-4)12-18(2)30-22/h7-8,12-14,16-17,27-28H,5-6,9-11,15H2,1-4H3/t17-/m1/s1 |
| InChIKey | YPMLMJWEIGUPME-QGZVFWFLSA-N |
| XLogP | 4.44 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|