C14H23ClN2O3SSi — CID 166042412
methyl 2-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]-5-chlorobenzoate (PubChem CID 166042412) has the molecular formula C14H23ClN2O3SSi and a molecular weight of 362.96 g/mol. Its IUPAC name is methyl 2-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]-5-chlorobenzoate.
| Compound Name | methyl 2-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]-5-chlorobenzoate |
|---|---|
| PubChem CID | 166042412 |
| Molecular Formula | C14H23ClN2O3SSi |
| Molecular Weight | 362.96 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | methyl 2-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]-5-chlorobenzoate |
| SMILES | [H]N=S(=O)(N[Si](C)(C)C(C)(C)C)c1ccc(Cl)cc1C(=O)OC |
| InChI | InChI=1S/C14H23ClN2O3SSi/c1-14(2,3)22(5,6)17-21(16,19)12-8-7-10(15)9-11(12)13(18)20-4/h7-9H,1-6H3,(H2,16,17,19) |
| InChIKey | OKJRLQZEAFNKLF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.96 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|