C17H11F3N4 — CID 166043207
9-methyl-5-(2,3,6-trifluorophenyl)-1,4-dihydropyrazolo[4,5-d][1,3]benzodiazepine (PubChem CID 166043207) has the molecular formula C17H11F3N4 and a molecular weight of 328.30 g/mol. Its IUPAC name is 9-methyl-5-(2,3,6-trifluorophenyl)-1,4-dihydropyrazolo[4,5-d][1,3]benzodiazepine.
| Compound Name | 9-methyl-5-(2,3,6-trifluorophenyl)-1,4-dihydropyrazolo[4,5-d][1,3]benzodiazepine |
|---|---|
| PubChem CID | 166043207 |
| Molecular Formula | C17H11F3N4 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 9-methyl-5-(2,3,6-trifluorophenyl)-1,4-dihydropyrazolo[4,5-d][1,3]benzodiazepine |
| SMILES | Cc1ccc2c(c1)-c1[nH]ncc1NC(c1c(F)ccc(F)c1F)=N2 |
| InChI | InChI=1S/C17H11F3N4/c1-8-2-5-12-9(6-8)16-13(7-21-24-16)23-17(22-12)14-10(18)3-4-11(19)15(14)20/h2-7H,1H3,(H,21,24)(H,22,23) |
| InChIKey | BPUGVRNGURUILU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|