C15H9ClFN5 — CID 166043227
8-(2-chloro-6-fluorophenyl)-3,4,7,9,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,8,11,13-hexaene (PubChem CID 166043227) has the molecular formula C15H9ClFN5 and a molecular weight of 313.72 g/mol. Its IUPAC name is 8-(2-chloro-6-fluorophenyl)-3,4,7,9,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,8,11,13-hexaene.
| Compound Name | 8-(2-chloro-6-fluorophenyl)-3,4,7,9,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,8,11,13-hexaene |
|---|---|
| PubChem CID | 166043227 |
| Molecular Formula | C15H9ClFN5 |
| Molecular Weight | 313.72 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 8-(2-chloro-6-fluorophenyl)-3,4,7,9,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,8,11,13-hexaene |
| SMILES | Fc1cccc(Cl)c1C1=Nc2ncccc2-c2[nH]ncc2N1 |
| InChI | InChI=1S/C15H9ClFN5/c16-9-4-1-5-10(17)12(9)15-20-11-7-19-22-13(11)8-3-2-6-18-14(8)21-15/h1-7H,(H,19,22)(H,18,20,21) |
| InChIKey | KSTQGPALCDHJMK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.72 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |