C15H8ClF2N5 — CID 166043300
8-(3-chloro-2,6-difluorophenyl)-3,4,7,9,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,8,11,13-hexaene (PubChem CID 166043300) has the molecular formula C15H8ClF2N5 and a molecular weight of 331.71 g/mol. Its IUPAC name is 8-(3-chloro-2,6-difluorophenyl)-3,4,7,9,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,8,11,13-hexaene.
| Compound Name | 8-(3-chloro-2,6-difluorophenyl)-3,4,7,9,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,8,11,13-hexaene |
|---|---|
| PubChem CID | 166043300 |
| Molecular Formula | C15H8ClF2N5 |
| Molecular Weight | 331.71 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 8-(3-chloro-2,6-difluorophenyl)-3,4,7,9,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,8,11,13-hexaene |
| SMILES | Fc1ccc(Cl)c(F)c1C1=Nc2ncccc2-c2[nH]ncc2N1 |
| InChI | InChI=1S/C15H8ClF2N5/c16-8-3-4-9(17)11(12(8)18)15-21-10-6-20-23-13(10)7-2-1-5-19-14(7)22-15/h1-6H,(H,20,23)(H,19,21,22) |
| InChIKey | SGSKBRQCFWAYBB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.71 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|