C20H19Cl2NO2 — CID 166044574
3-chloro-2-(2-chloroethoxy)-5-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)benzonitrile (PubChem CID 166044574) has the molecular formula C20H19Cl2NO2 and a molecular weight of 376.28 g/mol. Its IUPAC name is 3-chloro-2-(2-chloroethoxy)-5-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)benzonitrile.
| Compound Name | 3-chloro-2-(2-chloroethoxy)-5-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)benzonitrile |
|---|---|
| PubChem CID | 166044574 |
| Molecular Formula | C20H19Cl2NO2 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 3-chloro-2-(2-chloroethoxy)-5-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)benzonitrile |
| SMILES | COc1ccc2c(c1)CCCC2c1cc(Cl)c(OCCCl)c(C#N)c1 |
| InChI | InChI=1S/C20H19Cl2NO2/c1-24-16-5-6-18-13(10-16)3-2-4-17(18)14-9-15(12-23)20(19(22)11-14)25-8-7-21/h5-6,9-11,17H,2-4,7-8H2,1H3 |
| InChIKey | PRCFUTDBLUAJEK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|