C10H14BNO3 — CID 166045297
N-[2-(3-formyl-4-hydroxyphenyl)ethyl]-methylboronamidic acid (PubChem CID 166045297) has the molecular formula C10H14BNO3 and a molecular weight of 207.04 g/mol. Its IUPAC name is N-[2-(3-formyl-4-hydroxyphenyl)ethyl]-methylboronamidic acid.
| Compound Name | N-[2-(3-formyl-4-hydroxyphenyl)ethyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 166045297 |
| Molecular Formula | C10H14BNO3 |
| Molecular Weight | 207.04 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-[2-(3-formyl-4-hydroxyphenyl)ethyl]-methylboronamidic acid |
| SMILES | CB(O)NCCc1ccc(O)c(C=O)c1 |
| InChI | InChI=1S/C10H14BNO3/c1-11(15)12-5-4-8-2-3-10(14)9(6-8)7-13/h2-3,6-7,12,14-15H,4-5H2,1H3 |
| InChIKey | OUQMQAFBMLCCCR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.04 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|