C16H12BrN3O3S — CID 16604534
[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate (PubChem CID 16604534) has the molecular formula C16H12BrN3O3S and a molecular weight of 406.26 g/mol. Its IUPAC name is [5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate.
| Compound Name | [5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 16604534 |
| Molecular Formula | C16H12BrN3O3S |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | [5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate |
| SMILES | Cc1nc(/C=C/C(=O)OCc2nnc(-c3ccc(Br)cc3)o2)cs1 |
| InChI | InChI=1S/C16H12BrN3O3S/c1-10-18-13(9-24-10)6-7-15(21)22-8-14-19-20-16(23-14)11-2-4-12(17)5-3-11/h2-7,9H,8H2,1H3/b7-6+ |
| InChIKey | QJVLDDLTAZLFSM-VOTSOKGWSA-N |
| XLogP | 4.02 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|