C22H22ClF2N3O3 — CID 166045409
2-[(S)-(3-chloro-2,4-difluorophenyl)-[(3S)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-3-oxopiperazine-1-carboxamide (PubChem CID 166045409) has the molecular formula C22H22ClF2N3O3 and a molecular weight of 449.89 g/mol. Its IUPAC name is 2-[(S)-(3-chloro-2,4-difluorophenyl)-[(3S)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-3-oxopiperazine-1-carboxamide.
| Compound Name | 2-[(S)-(3-chloro-2,4-difluorophenyl)-[(3S)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 166045409 |
| Molecular Formula | C22H22ClF2N3O3 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 2-[(S)-(3-chloro-2,4-difluorophenyl)-[(3S)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-3-oxopiperazine-1-carboxamide |
| SMILES | CC1([C@H](c2ccc(F)c(Cl)c2F)[C@H]2COc3ccccc3C2)C(=O)NCCN1C(N)=O |
| InChI | InChI=1S/C22H22ClF2N3O3/c1-22(20(29)27-8-9-28(22)21(26)30)17(14-6-7-15(24)18(23)19(14)25)13-10-12-4-2-3-5-16(12)31-11-13/h2-7,13,17H,8-11H2,1H3,(H2,26,30)(H,27,29)/t13-,17+,22?/m1/s1 |
| InChIKey | PMXKKTJZFZGDOW-IZWDLXNHSA-N |
| XLogP | 3.22 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|