About (2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone
(2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone (PubChem CID 166045451) has the molecular formula C11H11BrF3NOS
and a molecular weight of 342.18 g/mol. Its IUPAC name is (2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone.
Molecular Properties
| Compound Name | (2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone |
| PubChem CID | 166045451 |
| Molecular Formula | C11H11BrF3NOS |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | (2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone |
| SMILES | O=C(c1csc(Br)n1)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H11BrF3NOS/c12-10-16-8(5-18-10)9(17)6-1-3-7(4-2-6)11(13,14)15/h5-7H,1-4H2 |
| InChIKey | WUPGOOACINCINZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone?
The IUPAC name of (2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone (CID 166045451) is (2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone.
What is the SMILES notation for (2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone?
The canonical SMILES for (2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone is O=C(c1csc(Br)n1)C1CCC(C(F)(F)F)CC1.
What is the InChIKey of (2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone?
The InChIKey is WUPGOOACINCINZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF3NOS/c12-10-16-8(5-18-10)9(17)6-1-3-7(4-2-6)11(13,14)15/h5-7H,1-4H2.
What are the key properties of (2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone?
(2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone has a molecular weight of 342.18 g/mol, XLogP of 4.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-1,3-thiazol-4-yl)-[4-(trifluoromethyl)cyclohexyl]methanone is sourced from PubChem (CID 166045451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).