C20H21N3S — CID 16604586
5-cyclopentyl-3-[(4-phenylphenyl)methylsulfanyl]-1H-1,2,4-triazole (PubChem CID 16604586) has the molecular formula C20H21N3S and a molecular weight of 335.48 g/mol. Its IUPAC name is 5-cyclopentyl-3-[(4-phenylphenyl)methylsulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-cyclopentyl-3-[(4-phenylphenyl)methylsulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 16604586 |
| Molecular Formula | C20H21N3S |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 5-cyclopentyl-3-[(4-phenylphenyl)methylsulfanyl]-1H-1,2,4-triazole |
| SMILES | c1ccc(-c2ccc(CSc3n[nH]c(C4CCCC4)n3)cc2)cc1 |
| InChI | InChI=1S/C20H21N3S/c1-2-6-16(7-3-1)17-12-10-15(11-13-17)14-24-20-21-19(22-23-20)18-8-4-5-9-18/h1-3,6-7,10-13,18H,4-5,8-9,14H2,(H,21,22,23) |
| InChIKey | JGJBGBLEAFEIOO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |