About 5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate
5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate (PubChem CID 166046357) has the molecular formula C4H5N2OS3-
and a molecular weight of 193.30 g/mol. Its IUPAC name is 5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate.
Molecular Properties
| Compound Name | 5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate |
| PubChem CID | 166046357 |
| Molecular Formula | C4H5N2OS3- |
| Molecular Weight | 193.30 g/mol |
| Exact Mass | 192.96 |
| IUPAC Name | 5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate |
| SMILES | COCSc1nnc([S-])s1 |
| InChI | InChI=1S/C4H6N2OS3/c1-7-2-9-4-6-5-3(8)10-4/h2H2,1H3,(H,5,8)/p-1 |
| InChIKey | MTNLIXRBDVGSBB-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate?
The IUPAC name of 5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate (CID 166046357) is 5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate.
What is the SMILES notation for 5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate?
The canonical SMILES for 5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate is COCSc1nnc([S-])s1.
What is the InChIKey of 5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate?
The InChIKey is MTNLIXRBDVGSBB-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6N2OS3/c1-7-2-9-4-6-5-3(8)10-4/h2H2,1H3,(H,5,8)/p-1.
What are the key properties of 5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate?
5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate has a molecular weight of 193.30 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethylsulfanyl)-1,3,4-thiadiazole-2-thiolate is sourced from PubChem (CID 166046357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).