C15H24N8S — CID 16604662
6-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 16604662) has the molecular formula C15H24N8S and a molecular weight of 348.48 g/mol. Its IUPAC name is 6-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 16604662 |
| Molecular Formula | C15H24N8S |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 6-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc(CSc2n[nH]c(CCC3CCCC3)n2)n1 |
| InChI | InChI=1S/C15H24N8S/c1-23(2)14-18-12(17-13(16)20-14)9-24-15-19-11(21-22-15)8-7-10-5-3-4-6-10/h10H,3-9H2,1-2H3,(H,19,21,22)(H2,16,17,18,20) |
| InChIKey | DFMJLHVBOPTEPA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |