C22H33ClFN5 — CID 166046828
4-chloro-3-(cyclopropylmethyl)-2-[1-(4-ethyl-1,4-diazepan-1-yl)butyl]-6-fluoro-4H-pyrido[2,3-d]pyrimidine (PubChem CID 166046828) has the molecular formula C22H33ClFN5 and a molecular weight of 421.99 g/mol. Its IUPAC name is 4-chloro-3-(cyclopropylmethyl)-2-[1-(4-ethyl-1,4-diazepan-1-yl)butyl]-6-fluoro-4H-pyrido[2,3-d]pyrimidine.
| Compound Name | 4-chloro-3-(cyclopropylmethyl)-2-[1-(4-ethyl-1,4-diazepan-1-yl)butyl]-6-fluoro-4H-pyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 166046828 |
| Molecular Formula | C22H33ClFN5 |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 4-chloro-3-(cyclopropylmethyl)-2-[1-(4-ethyl-1,4-diazepan-1-yl)butyl]-6-fluoro-4H-pyrido[2,3-d]pyrimidine |
| SMILES | CCCC(C1=Nc2ncc(F)cc2C(Cl)N1CC1CC1)N1CCCN(CC)CC1 |
| InChI | InChI=1S/C22H33ClFN5/c1-3-6-19(28-10-5-9-27(4-2)11-12-28)22-26-21-18(13-17(24)14-25-21)20(23)29(22)15-16-7-8-16/h13-14,16,19-20H,3-12,15H2,1-2H3 |
| InChIKey | MBJZTDGGWBADSH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 34.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|