C68H38N4S2 — CID 166047064
2,5-bis(2,3,4,5,6-pentadeuteriophenyl)-4,6-bis(4-phenyl-[1]benzothiolo[2,3-a]carbazol-12-yl)benzene-1,3-dicarbonitrile (PubChem CID 166047064) has the molecular formula C68H38N4S2 and a molecular weight of 985.28 g/mol. Its IUPAC name is 2,5-bis(2,3,4,5,6-pentadeuteriophenyl)-4,6-bis(4-phenyl-[1]benzothiolo[2,3-a]carbazol-12-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 2,5-bis(2,3,4,5,6-pentadeuteriophenyl)-4,6-bis(4-phenyl-[1]benzothiolo[2,3-a]carbazol-12-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 166047064 |
| Molecular Formula | C68H38N4S2 |
| Molecular Weight | 985.28 g/mol |
| Exact Mass | 984.32 |
| IUPAC Name | 2,5-bis(2,3,4,5,6-pentadeuteriophenyl)-4,6-bis(4-phenyl-[1]benzothiolo[2,3-a]carbazol-12-yl)benzene-1,3-dicarbonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c(C#N)c(-n3c4cccc(-c5ccccc5)c4c4ccc5c6ccccc6sc5c43)c(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c(-n3c4cccc(-c5ccccc5)c4c4ccc5c6ccccc6sc5c43)c2C#N)c([2H])c1[2H] |
| InChI | InChI=1S/C68H38N4S2/c69-39-53-59(43-23-9-3-10-24-43)54(40-70)64(72-56-32-18-30-46(42-21-7-2-8-22-42)62(56)52-38-36-50-48-28-14-16-34-58(48)74-68(50)66(52)72)60(44-25-11-4-12-26-44)63(53)71-55-31-17-29-45(41-19-5-1-6-20-41)61(55)51-37-35-49-47-27-13-15-33-57(47)73-67(49)65(51)71/h1-38H/i3D,4D,9D,10D,11D,12D,23D,24D,25D,26D |
| InChIKey | ORSMWXNGYQDBCB-VRZVXERLSA-N |
| XLogP | 19.03 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.28 |
| LogP ≤ 5 | 19.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |