About dichloropalladium;bis(2-isocyano-2-methylpropane)
dichloropalladium;bis(2-isocyano-2-methylpropane) (PubChem CID 166047730) has the molecular formula C10H18Cl2N2Pd
and a molecular weight of 343.59 g/mol. Its IUPAC name is dichloropalladium;bis(2-isocyano-2-methylpropane).
Molecular Properties
| Compound Name | dichloropalladium;bis(2-isocyano-2-methylpropane) |
| PubChem CID | 166047730 |
| Molecular Formula | C10H18Cl2N2Pd |
| Molecular Weight | 343.59 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | dichloropalladium;bis(2-isocyano-2-methylpropane) |
| SMILES | Cl[Pd]Cl.[C-]#[N+]C(C)(C)C.[C-]#[N+]C(C)(C)C |
| InChI | InChI=1S/2C5H9N.2ClH.Pd/c2*1-5(2,3)6-4;;;/h2*1-3H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | IAEOWCDGISANMK-UHFFFAOYSA-L |
| XLogP | 4.78 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichloropalladium;bis(2-isocyano-2-methylpropane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloropalladium;bis(2-isocyano-2-methylpropane)?
The IUPAC name of dichloropalladium;bis(2-isocyano-2-methylpropane) (CID 166047730) is dichloropalladium;bis(2-isocyano-2-methylpropane).
What is the SMILES notation for dichloropalladium;bis(2-isocyano-2-methylpropane)?
The canonical SMILES for dichloropalladium;bis(2-isocyano-2-methylpropane) is Cl[Pd]Cl.[C-]#[N+]C(C)(C)C.[C-]#[N+]C(C)(C)C.
What is the InChIKey of dichloropalladium;bis(2-isocyano-2-methylpropane)?
The InChIKey is IAEOWCDGISANMK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H9N.2ClH.Pd/c2*1-5(2,3)6-4;;;/h2*1-3H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloropalladium;bis(2-isocyano-2-methylpropane)?
dichloropalladium;bis(2-isocyano-2-methylpropane) has a molecular weight of 343.59 g/mol, XLogP of 4.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloropalladium;bis(2-isocyano-2-methylpropane) is sourced from PubChem (CID 166047730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).