C21H14ClF3N6O2 — CID 166047893
6-[(6-chloro-2-methylindazol-5-yl)amino]-3-prop-2-ynyl-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione (PubChem CID 166047893) has the molecular formula C21H14ClF3N6O2 and a molecular weight of 474.83 g/mol. Its IUPAC name is 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-prop-2-ynyl-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-prop-2-ynyl-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 166047893 |
| Molecular Formula | C21H14ClF3N6O2 |
| Molecular Weight | 474.83 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-prop-2-ynyl-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione |
| SMILES | C#CCn1c(=O)nc(Nc2cc3cn(C)nc3cc2Cl)n(Cc2cc(F)c(F)cc2F)c1=O |
| InChI | InChI=1S/C21H14ClF3N6O2/c1-3-4-30-20(32)27-19(26-18-6-12-9-29(2)28-17(12)7-13(18)22)31(21(30)33)10-11-5-15(24)16(25)8-14(11)23/h1,5-9H,4,10H2,2H3,(H,26,27,32) |
| InChIKey | SUBHIGNLQPEKOC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.83 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|