C74H65N — CID 166049015
9,9-dimethyl-N-(4-phenylphenyl)-N-[4-[2'-[2-(2,2,5,5-tetramethylhexan-3-yl)phenyl]-9,9'-spirobi[fluorene]-2-yl]phenyl]fluoren-2-amine (PubChem CID 166049015) has the molecular formula C74H65N and a molecular weight of 968.34 g/mol. Its IUPAC name is 9,9-dimethyl-N-(4-phenylphenyl)-N-[4-[2'-[2-(2,2,5,5-tetramethylhexan-3-yl)phenyl]-9,9'-spirobi[fluorene]-2-yl]phenyl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-(4-phenylphenyl)-N-[4-[2'-[2-(2,2,5,5-tetramethylhexan-3-yl)phenyl]-9,9'-spirobi[fluorene]-2-yl]phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 166049015 |
| Molecular Formula | C74H65N |
| Molecular Weight | 968.34 g/mol |
| Exact Mass | 967.51 |
| IUPAC Name | 9,9-dimethyl-N-(4-phenylphenyl)-N-[4-[2'-[2-(2,2,5,5-tetramethylhexan-3-yl)phenyl]-9,9'-spirobi[fluorene]-2-yl]phenyl]fluoren-2-amine |
| SMILES | CC(C)(C)CC(c1ccccc1-c1ccc2c(c1)C1(c3ccccc3-c3ccc(-c4ccc(N(c5ccc(-c6ccccc6)cc5)c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc4)cc31)c1ccccc1-2)C(C)(C)C |
| InChI | InChI=1S/C74H65N/c1-71(2,3)47-70(72(4,5)6)57-23-13-12-22-56(57)52-35-42-63-60-26-16-19-29-66(60)74(69(63)45-52)65-28-18-15-25-59(65)62-41-34-51(44-68(62)74)50-32-38-54(39-33-50)75(53-36-30-49(31-37-53)48-20-10-9-11-21-48)55-40-43-61-58-24-14-17-27-64(58)73(7,8)67(61)46-55/h9-46,70H,47H2,1-8H3 |
| InChIKey | VCBAMOYEKNVHDU-UHFFFAOYSA-N |
| XLogP | 20.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.34 |
| LogP ≤ 5 | 20.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |