C16H14N4O4 — CID 166049440
(4-nitrophenyl) N-(1-imidazo[1,2-a]pyridin-5-ylethyl)carbamate (PubChem CID 166049440) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is (4-nitrophenyl) N-(1-imidazo[1,2-a]pyridin-5-ylethyl)carbamate.
| Compound Name | (4-nitrophenyl) N-(1-imidazo[1,2-a]pyridin-5-ylethyl)carbamate |
|---|---|
| PubChem CID | 166049440 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | (4-nitrophenyl) N-(1-imidazo[1,2-a]pyridin-5-ylethyl)carbamate |
| SMILES | CC(NC(=O)Oc1ccc([N+](=O)[O-])cc1)c1cccc2nccn12 |
| InChI | InChI=1S/C16H14N4O4/c1-11(14-3-2-4-15-17-9-10-19(14)15)18-16(21)24-13-7-5-12(6-8-13)20(22)23/h2-11H,1H3,(H,18,21) |
| InChIKey | IOGXJWNSCJKZCV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|