C10H12N2O3S — CID 166050469
1-methylsulfonyl-2,3-dihydroindole-3-carboxamide (PubChem CID 166050469) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 1-methylsulfonyl-2,3-dihydroindole-3-carboxamide.
| Compound Name | 1-methylsulfonyl-2,3-dihydroindole-3-carboxamide |
|---|---|
| PubChem CID | 166050469 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1-methylsulfonyl-2,3-dihydroindole-3-carboxamide |
| SMILES | CS(=O)(=O)N1CC(C(N)=O)c2ccccc21 |
| InChI | InChI=1S/C10H12N2O3S/c1-16(14,15)12-6-8(10(11)13)7-4-2-3-5-9(7)12/h2-5,8H,6H2,1H3,(H2,11,13) |
| InChIKey | JDKFXKIZLRAEBI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |