About 1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one
1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one (PubChem CID 166050476) has the molecular formula C10H14N2O
and a molecular weight of 178.24 g/mol. Its IUPAC name is 1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one.
Molecular Properties
| Compound Name | 1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one |
| PubChem CID | 166050476 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one |
| SMILES | CC(C)N1CCn2c1cccc2=O |
| InChI | InChI=1S/C10H14N2O/c1-8(2)11-6-7-12-9(11)4-3-5-10(12)13/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | SELVPLLUBWQDLK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one?
The IUPAC name of 1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one (CID 166050476) is 1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one.
What is the SMILES notation for 1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one?
The canonical SMILES for 1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one is CC(C)N1CCn2c1cccc2=O.
What is the InChIKey of 1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one?
The InChIKey is SELVPLLUBWQDLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-8(2)11-6-7-12-9(11)4-3-5-10(12)13/h3-5,8H,6-7H2,1-2H3.
What are the key properties of 1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one?
1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one has a molecular weight of 178.24 g/mol, XLogP of 1.08, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-2,3-dihydroimidazo[1,2-a]pyridin-5-one is sourced from PubChem (CID 166050476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).