About [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate
[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate (PubChem CID 16605186) has the molecular formula C18H14ClFN2O5S
and a molecular weight of 424.84 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate |
| PubChem CID | 16605186 |
| Molecular Formula | C18H14ClFN2O5S |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)OCc2cc(-c3ccc(Cl)cc3)no2)c1 |
| InChI | InChI=1S/C18H14ClFN2O5S/c1-21-28(24,25)14-6-7-16(20)15(9-14)18(23)26-10-13-8-17(22-27-13)11-2-4-12(19)5-3-11/h2-9,21H,10H2,1H3 |
| InChIKey | SEYWCXHREYYBDN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate?
The IUPAC name of [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate (CID 16605186) is [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate.
What is the SMILES notation for [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate?
The canonical SMILES for [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate is CNS(=O)(=O)c1ccc(F)c(C(=O)OCc2cc(-c3ccc(Cl)cc3)no2)c1.
What is the InChIKey of [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate?
The InChIKey is SEYWCXHREYYBDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClFN2O5S/c1-21-28(24,25)14-6-7-16(20)15(9-14)18(23)26-10-13-8-17(22-27-13)11-2-4-12(19)5-3-11/h2-9,21H,10H2,1H3.
What are the key properties of [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate?
[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate has a molecular weight of 424.84 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 2-fluoro-5-(methylsulfamoyl)benzoate is sourced from PubChem (CID 16605186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).