About dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate
dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate (PubChem CID 16605332) has the molecular formula C16H22N2O8S2
and a molecular weight of 434.49 g/mol. Its IUPAC name is dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate |
| PubChem CID | 16605332 |
| Molecular Formula | C16H22N2O8S2 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1COC(=O)C1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H22N2O8S2/c1-24-15(20)11-10(12(16(21)25-2)27-13(11)17)8-26-14(19)9-4-6-18(7-5-9)28(3,22)23/h9H,4-8,17H2,1-3H3 |
| InChIKey | WZNYUIPILDHNHZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 142.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate?
The IUPAC name of dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate (CID 16605332) is dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate.
What is the SMILES notation for dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate?
The canonical SMILES for dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate is COC(=O)c1sc(N)c(C(=O)OC)c1COC(=O)C1CCN(S(C)(=O)=O)CC1.
What is the InChIKey of dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate?
The InChIKey is WZNYUIPILDHNHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O8S2/c1-24-15(20)11-10(12(16(21)25-2)27-13(11)17)8-26-14(19)9-4-6-18(7-5-9)28(3,22)23/h9H,4-8,17H2,1-3H3.
What are the key properties of dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate?
dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate has a molecular weight of 434.49 g/mol, XLogP of 0.62, 6 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 5-amino-3-[(1-methylsulfonylpiperidine-4-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate is sourced from PubChem (CID 16605332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).