C31H30NO+ — CID 166053576
3,19,23,24-tetramethyl-10-(2-methylpropyl)-16-oxa-3-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(24),2(15),3,5,7,9,11,13,17,19,21(25),22-dodecaene (PubChem CID 166053576) has the molecular formula C31H30NO+ and a molecular weight of 432.59 g/mol. Its IUPAC name is 3,19,23,24-tetramethyl-10-(2-methylpropyl)-16-oxa-3-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(24),2(15),3,5,7,9,11,13,17,19,21(25),22-dodecaene.
| Compound Name | 3,19,23,24-tetramethyl-10-(2-methylpropyl)-16-oxa-3-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(24),2(15),3,5,7,9,11,13,17,19,21(25),22-dodecaene |
|---|---|
| PubChem CID | 166053576 |
| Molecular Formula | C31H30NO+ |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 3,19,23,24-tetramethyl-10-(2-methylpropyl)-16-oxa-3-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(24),2(15),3,5,7,9,11,13,17,19,21(25),22-dodecaene |
| SMILES | Cc1cc2c3c(c(C)c(C)cc3c1)-c1c(cc3cc4c(CC(C)C)cccc4cc3[n+]1C)O2 |
| InChI | InChI=1S/C31H30NO/c1-17(2)10-21-8-7-9-22-15-26-23(14-25(21)22)16-28-31(32(26)6)29-20(5)19(4)13-24-11-18(3)12-27(33-28)30(24)29/h7-9,11-17H,10H2,1-6H3/q+1 |
| InChIKey | QZWDIYMKBRWMHV-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|