C27H27FNO+ — CID 166054026
15-(2,2-dimethylpropyl)-8-fluoro-3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene (PubChem CID 166054026) has the molecular formula C27H27FNO+ and a molecular weight of 400.52 g/mol. Its IUPAC name is 15-(2,2-dimethylpropyl)-8-fluoro-3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene.
| Compound Name | 15-(2,2-dimethylpropyl)-8-fluoro-3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 166054026 |
| Molecular Formula | C27H27FNO+ |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 15-(2,2-dimethylpropyl)-8-fluoro-3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
| SMILES | Cc1cc2cc(CC(C)(C)C)cc3c2c(c1C)-c1c(c2cc(F)ccc2c[n+]1C)O3 |
| InChI | InChI=1S/C27H27FNO/c1-15-9-19-10-17(13-27(3,4)5)11-22-24(19)23(16(15)2)25-26(30-22)21-12-20(28)8-7-18(21)14-29(25)6/h7-12,14H,13H2,1-6H3/q+1 |
| InChIKey | XFAUTXFHUYGDDZ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|