C27H25N2O+ — CID 166054754
2,2-dimethyl-3-(3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13,15,17(21),18-decaen-6-yl)propanenitrile (PubChem CID 166054754) has the molecular formula C27H25N2O+ and a molecular weight of 393.51 g/mol. Its IUPAC name is 2,2-dimethyl-3-(3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13,15,17(21),18-decaen-6-yl)propanenitrile.
| Compound Name | 2,2-dimethyl-3-(3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13,15,17(21),18-decaen-6-yl)propanenitrile |
|---|---|
| PubChem CID | 166054754 |
| Molecular Formula | C27H25N2O+ |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2,2-dimethyl-3-(3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13,15,17(21),18-decaen-6-yl)propanenitrile |
| SMILES | Cc1cc2cccc3c2c(c1C)-c1c(cc2ccc(CC(C)(C)C#N)cc2[n+]1C)O3 |
| InChI | InChI=1S/C27H25N2O/c1-16-11-20-7-6-8-22-25(20)24(17(16)2)26-23(30-22)13-19-10-9-18(12-21(19)29(26)5)14-27(3,4)15-28/h6-13H,14H2,1-5H3/q+1 |
| InChIKey | YLEYZWZVWNHJKE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 36.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|