C28H32Cl2FN5O5 — CID 166056625
tert-butyl (2R,5R)-4-[7-chloro-6-fluoro-3-nitro-2-oxo-1-(2-propan-2-ylphenyl)-1,8-naphthyridin-4-yl]-5-(chloromethyl)-2-methylpiperazine-1-carboxylate (PubChem CID 166056625) has the molecular formula C28H32Cl2FN5O5 and a molecular weight of 608.50 g/mol. Its IUPAC name is tert-butyl (2R,5R)-4-[7-chloro-6-fluoro-3-nitro-2-oxo-1-(2-propan-2-ylphenyl)-1,8-naphthyridin-4-yl]-5-(chloromethyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5R)-4-[7-chloro-6-fluoro-3-nitro-2-oxo-1-(2-propan-2-ylphenyl)-1,8-naphthyridin-4-yl]-5-(chloromethyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 166056625 |
| Molecular Formula | C28H32Cl2FN5O5 |
| Molecular Weight | 608.50 g/mol |
| Exact Mass | 607.18 |
| IUPAC Name | tert-butyl (2R,5R)-4-[7-chloro-6-fluoro-3-nitro-2-oxo-1-(2-propan-2-ylphenyl)-1,8-naphthyridin-4-yl]-5-(chloromethyl)-2-methylpiperazine-1-carboxylate |
| SMILES | CC(C)c1ccccc1-n1c(=O)c([N+](=O)[O-])c(N2C[C@@H](C)N(C(=O)OC(C)(C)C)C[C@@H]2CCl)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C28H32Cl2FN5O5/c1-15(2)18-9-7-8-10-21(18)35-25-19(11-20(31)24(30)32-25)22(23(26(35)37)36(39)40)34-13-16(3)33(14-17(34)12-29)27(38)41-28(4,5)6/h7-11,15-17H,12-14H2,1-6H3/t16-,17+/m1/s1 |
| InChIKey | FATJAGBJENVBLC-SJORKVTESA-N |
| XLogP | 6.26 |
| TPSA | 110.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.50 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|