C27H27N3O3 — CID 16605709
N-methyl-2-(9-oxoacridin-10-yl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]acetamide (PubChem CID 16605709) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-methyl-2-(9-oxoacridin-10-yl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]acetamide.
| Compound Name | N-methyl-2-(9-oxoacridin-10-yl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 16605709 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-methyl-2-(9-oxoacridin-10-yl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CN(C)C(=O)Cn2c3ccccc3c(=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C27H27N3O3/c1-17-13-18(2)26(19(3)14-17)28-24(31)15-29(4)25(32)16-30-22-11-7-5-9-20(22)27(33)21-10-6-8-12-23(21)30/h5-14H,15-16H2,1-4H3,(H,28,31) |
| InChIKey | QHQVJTJJKXGLCG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|