About 4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide
4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide (PubChem CID 166058003) has the molecular formula C12H12BrN3S
and a molecular weight of 310.22 g/mol. Its IUPAC name is 4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide |
| PubChem CID | 166058003 |
| Molecular Formula | C12H12BrN3S |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.Cc1[nH]c2ccccc2c1-c1csc(N)n1 |
| InChI | InChI=1S/C12H11N3S.BrH/c1-7-11(10-6-16-12(13)15-10)8-4-2-3-5-9(8)14-7;/h2-6,14H,1H3,(H2,13,15);1H |
| InChIKey | MZDKHEVAKDGRLV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide?
The IUPAC name of 4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide (CID 166058003) is 4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide.
What is the SMILES notation for 4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide?
The canonical SMILES for 4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide is Br.Cc1[nH]c2ccccc2c1-c1csc(N)n1.
What is the InChIKey of 4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide?
The InChIKey is MZDKHEVAKDGRLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3S.BrH/c1-7-11(10-6-16-12(13)15-10)8-4-2-3-5-9(8)14-7;/h2-6,14H,1H3,(H2,13,15);1H.
What are the key properties of 4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide?
4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide has a molecular weight of 310.22 g/mol, XLogP of 3.76, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine;hydrobromide is sourced from PubChem (CID 166058003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).