C30H39N3O4 — CID 166058996
propan-2-yl N-[(2S,3S,4S)-1-acetyl-2-ethyl-6-[4-(hex-5-enoylamino)phenyl]-3-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate (PubChem CID 166058996) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is propan-2-yl N-[(2S,3S,4S)-1-acetyl-2-ethyl-6-[4-(hex-5-enoylamino)phenyl]-3-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate.
| Compound Name | propan-2-yl N-[(2S,3S,4S)-1-acetyl-2-ethyl-6-[4-(hex-5-enoylamino)phenyl]-3-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate |
|---|---|
| PubChem CID | 166058996 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | propan-2-yl N-[(2S,3S,4S)-1-acetyl-2-ethyl-6-[4-(hex-5-enoylamino)phenyl]-3-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate |
| SMILES | C=CCCCC(=O)Nc1ccc(-c2ccc3c(c2)[C@@H](NC(=O)OC(C)C)[C@H](C)[C@H](CC)N3C(C)=O)cc1 |
| InChI | InChI=1S/C30H39N3O4/c1-7-9-10-11-28(35)31-24-15-12-22(13-16-24)23-14-17-27-25(18-23)29(32-30(36)37-19(3)4)20(5)26(8-2)33(27)21(6)34/h7,12-20,26,29H,1,8-11H2,2-6H3,(H,31,35)(H,32,36)/t20-,26+,29+/m1/s1 |
| InChIKey | WZZFMOYVTGESSP-OBBJCRILSA-N |
| XLogP | 6.61 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|