C18H11F9O — CID 166059754
(E)-4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)-3-[2-(trifluoromethyl)phenyl]pent-1-en-3-ol (PubChem CID 166059754) has the molecular formula C18H11F9O and a molecular weight of 414.27 g/mol. Its IUPAC name is (E)-4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)-3-[2-(trifluoromethyl)phenyl]pent-1-en-3-ol.
| Compound Name | (E)-4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)-3-[2-(trifluoromethyl)phenyl]pent-1-en-3-ol |
|---|---|
| PubChem CID | 166059754 |
| Molecular Formula | C18H11F9O |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | (E)-4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)-3-[2-(trifluoromethyl)phenyl]pent-1-en-3-ol |
| SMILES | OC(/C=C/c1ccc(F)cc1)(c1ccccc1C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H11F9O/c19-12-7-5-11(6-8-12)9-10-15(28,17(23,24)18(25,26)27)13-3-1-2-4-14(13)16(20,21)22/h1-10,28H/b10-9+ |
| InChIKey | KCIGOTXRECTVDB-MDZDMXLPSA-N |
| XLogP | 5.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|