C21H14F6O — CID 166059809
(E)-4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)-3-naphthalen-2-ylpent-1-en-3-ol (PubChem CID 166059809) has the molecular formula C21H14F6O and a molecular weight of 396.33 g/mol. Its IUPAC name is (E)-4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)-3-naphthalen-2-ylpent-1-en-3-ol.
| Compound Name | (E)-4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)-3-naphthalen-2-ylpent-1-en-3-ol |
|---|---|
| PubChem CID | 166059809 |
| Molecular Formula | C21H14F6O |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (E)-4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)-3-naphthalen-2-ylpent-1-en-3-ol |
| SMILES | OC(/C=C/c1ccc(F)cc1)(c1ccc2ccccc2c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H14F6O/c22-18-9-5-14(6-10-18)11-12-19(28,20(23,24)21(25,26)27)17-8-7-15-3-1-2-4-16(15)13-17/h1-13,28H/b12-11+ |
| InChIKey | OXTOOQVLZHEKCG-VAWYXSNFSA-N |
| XLogP | 6.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|