C19H24F13N — CID 166059861
4-methyl-4-prop-2-enyl-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)hept-6-en-2-amine (PubChem CID 166059861) has the molecular formula C19H24F13N and a molecular weight of 513.38 g/mol. Its IUPAC name is 4-methyl-4-prop-2-enyl-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)hept-6-en-2-amine.
| Compound Name | 4-methyl-4-prop-2-enyl-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)hept-6-en-2-amine |
|---|---|
| PubChem CID | 166059861 |
| Molecular Formula | C19H24F13N |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 4-methyl-4-prop-2-enyl-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)hept-6-en-2-amine |
| SMILES | C=CCC(C)(CC=C)CC(C)NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H24F13N/c1-5-7-13(4,8-6-2)11-12(3)33-10-9-14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h5-6,12,33H,1-2,7-11H2,3-4H3 |
| InChIKey | XDFMCBMXHMMQTG-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|