C24H21ClF6N5O4P — CID 166059887
(3R)-3-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphospholan-2-yl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 166059887) has the molecular formula C24H21ClF6N5O4P and a molecular weight of 623.88 g/mol. Its IUPAC name is (3R)-3-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphospholan-2-yl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphospholan-2-yl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 166059887 |
| Molecular Formula | C24H21ClF6N5O4P |
| Molecular Weight | 623.88 g/mol |
| Exact Mass | 623.09 |
| IUPAC Name | (3R)-3-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphospholan-2-yl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | O=C(C[C@@H](Cc1cc(F)c(F)cc1F)NP1(=O)OCC(c2cccc(Cl)c2)O1)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C24H21ClF6N5O4P/c25-15-3-1-2-13(6-15)20-12-39-41(38,40-20)34-16(7-14-8-18(27)19(28)10-17(14)26)9-22(37)35-4-5-36-21(11-35)32-33-23(36)24(29,30)31/h1-3,6,8,10,16,20H,4-5,7,9,11-12H2,(H,34,38)/t16-,20?,41?/m1/s1 |
| InChIKey | UXAFDEVOZDPGQM-FDIXKCRDSA-N |
| XLogP | 5.20 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.88 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|