C30H27ClN4O7S — CID 166060403
benzhydryl (2S,3R,5R)-3-[(E)-[[2-[(2-chloro-3,4-dihydroxybenzoyl)amino]acetyl]hydrazinylidene]methyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 166060403) has the molecular formula C30H27ClN4O7S and a molecular weight of 623.09 g/mol. Its IUPAC name is benzhydryl (2S,3R,5R)-3-[(E)-[[2-[(2-chloro-3,4-dihydroxybenzoyl)amino]acetyl]hydrazinylidene]methyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl (2S,3R,5R)-3-[(E)-[[2-[(2-chloro-3,4-dihydroxybenzoyl)amino]acetyl]hydrazinylidene]methyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 166060403 |
| Molecular Formula | C30H27ClN4O7S |
| Molecular Weight | 623.09 g/mol |
| Exact Mass | 622.13 |
| IUPAC Name | benzhydryl (2S,3R,5R)-3-[(E)-[[2-[(2-chloro-3,4-dihydroxybenzoyl)amino]acetyl]hydrazinylidene]methyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@@]1(/C=N/NC(=O)CNC(=O)c2ccc(O)c(O)c2Cl)S[C@@H]2CC(=O)N2[C@H]1C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H27ClN4O7S/c1-30(16-33-34-21(37)15-32-28(40)19-12-13-20(36)25(39)24(19)31)27(35-22(38)14-23(35)43-30)29(41)42-26(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-13,16,23,26-27,36,39H,14-15H2,1H3,(H,32,40)(H,34,37)/b33-16+/t23-,27+,30+/m1/s1 |
| InChIKey | ICIQZLRHOCBDMZ-YQZHWILASA-N |
| XLogP | 3.35 |
| TPSA | 157.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.09 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|