C22H34O4 — CID 166060744
2-butyl-2-(6-butyl-1-tert-butylcyclohexa-2,4-dien-1-yl)-1,3-dioxane-4,6-dione (PubChem CID 166060744) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-butyl-2-(6-butyl-1-tert-butylcyclohexa-2,4-dien-1-yl)-1,3-dioxane-4,6-dione.
| Compound Name | 2-butyl-2-(6-butyl-1-tert-butylcyclohexa-2,4-dien-1-yl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 166060744 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-butyl-2-(6-butyl-1-tert-butylcyclohexa-2,4-dien-1-yl)-1,3-dioxane-4,6-dione |
| SMILES | CCCCC1C=CC=CC1(C(C)(C)C)C1(CCCC)OC(=O)CC(=O)O1 |
| InChI | InChI=1S/C22H34O4/c1-6-8-12-17-13-10-11-14-21(17,20(3,4)5)22(15-9-7-2)25-18(23)16-19(24)26-22/h10-11,13-14,17H,6-9,12,15-16H2,1-5H3 |
| InChIKey | IPIPCPSRUHUUMT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|