C14H22N5NaO6S — CID 166061054
sodium [(2S,5R)-2-[N-(1-methylpiperidine-4-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 166061054) has the molecular formula C14H22N5NaO6S and a molecular weight of 411.42 g/mol. Its IUPAC name is sodium [(2S,5R)-2-[N-(1-methylpiperidine-4-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-2-[N-(1-methylpiperidine-4-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 166061054 |
| Molecular Formula | C14H22N5NaO6S |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | sodium [(2S,5R)-2-[N-(1-methylpiperidine-4-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | [H]/N=C(\NC(=O)C1CCN(C)CC1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H23N5O6S.Na/c1-17-6-4-9(5-7-17)13(20)16-12(15)11-3-2-10-8-18(11)14(21)19(10)25-26(22,23)24;/h9-11H,2-8H2,1H3,(H2,15,16,20)(H,22,23,24);/q;+1/p-1/t10-,11+;/m1./s1 |
| InChIKey | LWNFISCEFFIXCG-DHXVBOOMSA-M |
| XLogP | -3.91 |
| TPSA | 146.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|