C15H15F3N4O6S — CID 166061078
[(2S,5R)-7-oxo-2-[N'-[4-(trifluoromethyl)benzoyl]carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 166061078) has the molecular formula C15H15F3N4O6S and a molecular weight of 436.37 g/mol. Its IUPAC name is [(2S,5R)-7-oxo-2-[N'-[4-(trifluoromethyl)benzoyl]carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-7-oxo-2-[N'-[4-(trifluoromethyl)benzoyl]carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 166061078 |
| Molecular Formula | C15H15F3N4O6S |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | [(2S,5R)-7-oxo-2-[N'-[4-(trifluoromethyl)benzoyl]carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\C(=O)c1ccc(C(F)(F)F)cc1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C15H15F3N4O6S/c16-15(17,18)9-3-1-8(2-4-9)13(23)20-12(19)11-6-5-10-7-21(11)14(24)22(10)28-29(25,26)27/h1-4,10-11H,5-7H2,(H2,19,20,23)(H,25,26,27)/t10-,11+/m1/s1 |
| InChIKey | QVGVLNUDJQBBTE-MNOVXSKESA-N |
| XLogP | 1.21 |
| TPSA | 142.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|