C9H14N5NaO6S — CID 166061082
sodium [(2S,5R)-2-[N-(2-aminoacetyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 166061082) has the molecular formula C9H14N5NaO6S and a molecular weight of 343.30 g/mol. Its IUPAC name is sodium [(2S,5R)-2-[N-(2-aminoacetyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-2-[N-(2-aminoacetyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 166061082 |
| Molecular Formula | C9H14N5NaO6S |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | sodium [(2S,5R)-2-[N-(2-aminoacetyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | [H]/N=C(\NC(=O)CN)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H15N5O6S.Na/c10-3-7(15)12-8(11)6-2-1-5-4-13(6)9(16)14(5)20-21(17,18)19;/h5-6H,1-4,10H2,(H2,11,12,15)(H,17,18,19);/q;+1/p-1/t5-,6+;/m1./s1 |
| InChIKey | NNHIVGGFKMEWHA-IBTYICNHSA-M |
| XLogP | -5.30 |
| TPSA | 168.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|