C12H17N6NaO6S — CID 166061096
sodium [(2S,5R)-7-oxo-2-[N-(3,4,5,6-tetrahydropyridazine-3-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 166061096) has the molecular formula C12H17N6NaO6S and a molecular weight of 396.36 g/mol. Its IUPAC name is sodium [(2S,5R)-7-oxo-2-[N-(3,4,5,6-tetrahydropyridazine-3-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-7-oxo-2-[N-(3,4,5,6-tetrahydropyridazine-3-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 166061096 |
| Molecular Formula | C12H17N6NaO6S |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | sodium [(2S,5R)-7-oxo-2-[N-(3,4,5,6-tetrahydropyridazine-3-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | [H]/N=C(\NC(=O)C1CCCN=N1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C12H18N6O6S.Na/c13-10(15-11(19)8-2-1-5-14-16-8)9-4-3-7-6-17(9)12(20)18(7)24-25(21,22)23;/h7-9H,1-6H2,(H2,13,15,19)(H,21,22,23);/q;+1/p-1/t7-,8?,9+;/m1./s1 |
| InChIKey | IRDGAKRRPGBMQC-DFWWGSRDSA-M |
| XLogP | -3.64 |
| TPSA | 167.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|