C15H22N5NaO7S — CID 166061117
sodium [(2S,5R)-2-[N-[(3R)-1-acetylpiperidine-3-carbonyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 166061117) has the molecular formula C15H22N5NaO7S and a molecular weight of 439.43 g/mol. Its IUPAC name is sodium [(2S,5R)-2-[N-[(3R)-1-acetylpiperidine-3-carbonyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-2-[N-[(3R)-1-acetylpiperidine-3-carbonyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 166061117 |
| Molecular Formula | C15H22N5NaO7S |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | sodium [(2S,5R)-2-[N-[(3R)-1-acetylpiperidine-3-carbonyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | [H]/N=C(\NC(=O)[C@@H]1CCCN(C(C)=O)C1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H23N5O7S.Na/c1-9(21)18-6-2-3-10(7-18)14(22)17-13(16)12-5-4-11-8-19(12)15(23)20(11)27-28(24,25)26;/h10-12H,2-8H2,1H3,(H2,16,17,22)(H,24,25,26);/q;+1/p-1/t10-,11-,12+;/m1./s1 |
| InChIKey | GFQFWIRZRIJVQL-HSASPSRMSA-M |
| XLogP | -4.00 |
| TPSA | 163.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|