C9H14N4O3 — CID 166061142
N-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]acetamide (PubChem CID 166061142) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is N-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]acetamide.
| Compound Name | N-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]acetamide |
|---|---|
| PubChem CID | 166061142 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]acetamide |
| SMILES | [H]/N=C(\NC(C)=O)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C9H14N4O3/c1-5(14)11-8(10)7-3-2-6-4-12(7)9(15)13(6)16/h6-7,16H,2-4H2,1H3,(H2,10,11,14)/t6-,7+/m1/s1 |
| InChIKey | OXQZCNURMHMWBN-RQJHMYQMSA-N |
| XLogP | -0.24 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|